C13H11FN2O3S — CID 155881784
5-fluoro-N-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]thiophene-2-carboxamide (PubChem CID 155881784) has the molecular formula C13H11FN2O3S and a molecular weight of 294.31 g/mol. Its IUPAC name is 5-fluoro-N-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]thiophene-2-carboxamide.
| Compound Name | 5-fluoro-N-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 155881784 |
| Molecular Formula | C13H11FN2O3S |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | 5-fluoro-N-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]thiophene-2-carboxamide |
| SMILES | COc1cc(/C=N/NC(=O)c2ccc(F)s2)ccc1O |
| InChI | InChI=1S/C13H11FN2O3S/c1-19-10-6-8(2-3-9(10)17)7-15-16-13(18)11-4-5-12(14)20-11/h2-7,17H,1H3,(H,16,18)/b15-7+ |
| InChIKey | INSVEOWUHJHOMA-VIZOYTHASA-N |
| XLogP | 2.37 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|