C25H22BF2N3O — CID 155888156
(PubChem CID 155888156) has the molecular formula C25H22BF2N3O and a molecular weight of 429.28 g/mol.
| Compound Name | |
|---|---|
| PubChem CID | 155888156 |
| Molecular Formula | C25H22BF2N3O |
| Molecular Weight | 429.28 g/mol |
| Exact Mass | 429.18 |
| IUPAC Name | — |
| SMILES | C#CCNC(=O)CCc1ccc2n1[B-](F)(F)[N+]1=C(C=CC=Cc3ccccc3)C=CC1=C2 |
| InChI | InChI=1S/C25H22BF2N3O/c1-2-18-29-25(32)17-16-22-13-15-24-19-23-14-12-21(30(23)26(27,28)31(22)24)11-7-6-10-20-8-4-3-5-9-20/h1,3-15,19H,16-18H2,(H,29,32) |
| InChIKey | OLFSHALJABVHGP-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 37.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.28 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|