About 5,5-difluoro-2-methyl-2,7-diazaspiro[3.5]nonane;dihydrochloride
5,5-difluoro-2-methyl-2,7-diazaspiro[3.5]nonane;dihydrochloride (PubChem CID 155895873) has the molecular formula C8H16Cl2F2N2
and a molecular weight of 249.13 g/mol. Its IUPAC name is 5,5-difluoro-2-methyl-2,7-diazaspiro[3.5]nonane;dihydrochloride.
Molecular Properties
| Compound Name | 5,5-difluoro-2-methyl-2,7-diazaspiro[3.5]nonane;dihydrochloride |
| PubChem CID | 155895873 |
| Molecular Formula | C8H16Cl2F2N2 |
| Molecular Weight | 249.13 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | 5,5-difluoro-2-methyl-2,7-diazaspiro[3.5]nonane;dihydrochloride |
| SMILES | CN1CC2(CCNCC2(F)F)C1.Cl.Cl |
| InChI | InChI=1S/C8H14F2N2.2ClH/c1-12-5-7(6-12)2-3-11-4-8(7,9)10;;/h11H,2-6H2,1H3;2*1H |
| InChIKey | FPUPAUITJFKIGW-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.13 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5,5-difluoro-2-methyl-2,7-diazaspiro[3.5]nonane;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-difluoro-2-methyl-2,7-diazaspiro[3.5]nonane;dihydrochloride?
The IUPAC name of 5,5-difluoro-2-methyl-2,7-diazaspiro[3.5]nonane;dihydrochloride (CID 155895873) is 5,5-difluoro-2-methyl-2,7-diazaspiro[3.5]nonane;dihydrochloride.
What is the SMILES notation for 5,5-difluoro-2-methyl-2,7-diazaspiro[3.5]nonane;dihydrochloride?
The canonical SMILES for 5,5-difluoro-2-methyl-2,7-diazaspiro[3.5]nonane;dihydrochloride is CN1CC2(CCNCC2(F)F)C1.Cl.Cl.
What is the InChIKey of 5,5-difluoro-2-methyl-2,7-diazaspiro[3.5]nonane;dihydrochloride?
The InChIKey is FPUPAUITJFKIGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14F2N2.2ClH/c1-12-5-7(6-12)2-3-11-4-8(7,9)10;;/h11H,2-6H2,1H3;2*1H.
What are the key properties of 5,5-difluoro-2-methyl-2,7-diazaspiro[3.5]nonane;dihydrochloride?
5,5-difluoro-2-methyl-2,7-diazaspiro[3.5]nonane;dihydrochloride has a molecular weight of 249.13 g/mol, XLogP of 1.39, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-difluoro-2-methyl-2,7-diazaspiro[3.5]nonane;dihydrochloride is sourced from PubChem (CID 155895873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).