C18H25N5O3 — CID 155900630
N-(1-hydroxybutan-2-yl)-1-methyl-4-(2-morpholin-4-ylpyrimidin-5-yl)pyrrole-2-carboxamide (PubChem CID 155900630) has the molecular formula C18H25N5O3 and a molecular weight of 359.43 g/mol. Its IUPAC name is N-(1-hydroxybutan-2-yl)-1-methyl-4-(2-morpholin-4-ylpyrimidin-5-yl)pyrrole-2-carboxamide.
| Compound Name | N-(1-hydroxybutan-2-yl)-1-methyl-4-(2-morpholin-4-ylpyrimidin-5-yl)pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 155900630 |
| Molecular Formula | C18H25N5O3 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | N-(1-hydroxybutan-2-yl)-1-methyl-4-(2-morpholin-4-ylpyrimidin-5-yl)pyrrole-2-carboxamide |
| SMILES | CCC(CO)NC(=O)c1cc(-c2cnc(N3CCOCC3)nc2)cn1C |
| InChI | InChI=1S/C18H25N5O3/c1-3-15(12-24)21-17(25)16-8-13(11-22(16)2)14-9-19-18(20-10-14)23-4-6-26-7-5-23/h8-11,15,24H,3-7,12H2,1-2H3,(H,21,25) |
| InChIKey | OACQAOKUKBDJST-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |