C20H22N2O4S — CID 155901554
(4aR,8aS)-1-methyl-7-(4-phenylphenyl)sulfonyl-4,4a,5,6,8,8a-hexahydropyrido[3,4-d][1,3]oxazin-2-one (PubChem CID 155901554) has the molecular formula C20H22N2O4S and a molecular weight of 386.47 g/mol. Its IUPAC name is (4aR,8aS)-1-methyl-7-(4-phenylphenyl)sulfonyl-4,4a,5,6,8,8a-hexahydropyrido[3,4-d][1,3]oxazin-2-one.
| Compound Name | (4aR,8aS)-1-methyl-7-(4-phenylphenyl)sulfonyl-4,4a,5,6,8,8a-hexahydropyrido[3,4-d][1,3]oxazin-2-one |
|---|---|
| PubChem CID | 155901554 |
| Molecular Formula | C20H22N2O4S |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | (4aR,8aS)-1-methyl-7-(4-phenylphenyl)sulfonyl-4,4a,5,6,8,8a-hexahydropyrido[3,4-d][1,3]oxazin-2-one |
| SMILES | CN1C(=O)OC[C@@H]2CCN(S(=O)(=O)c3ccc(-c4ccccc4)cc3)C[C@H]21 |
| InChI | InChI=1S/C20H22N2O4S/c1-21-19-13-22(12-11-17(19)14-26-20(21)23)27(24,25)18-9-7-16(8-10-18)15-5-3-2-4-6-15/h2-10,17,19H,11-14H2,1H3/t17-,19+/m0/s1 |
| InChIKey | JRVZOVOHOPNJBR-PKOBYXMFSA-N |
| XLogP | 2.81 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |