C16H24N4O3 — CID 155902271
[(1R,2R,3R,4S)-2,4-dihydroxy-3-(4-phenylpiperazin-1-yl)cyclopentyl]urea (PubChem CID 155902271) has the molecular formula C16H24N4O3 and a molecular weight of 320.39 g/mol. Its IUPAC name is [(1R,2R,3R,4S)-2,4-dihydroxy-3-(4-phenylpiperazin-1-yl)cyclopentyl]urea.
| Compound Name | [(1R,2R,3R,4S)-2,4-dihydroxy-3-(4-phenylpiperazin-1-yl)cyclopentyl]urea |
|---|---|
| PubChem CID | 155902271 |
| Molecular Formula | C16H24N4O3 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | [(1R,2R,3R,4S)-2,4-dihydroxy-3-(4-phenylpiperazin-1-yl)cyclopentyl]urea |
| SMILES | NC(=O)N[C@@H]1C[C@H](O)[C@@H](N2CCN(c3ccccc3)CC2)[C@@H]1O |
| InChI | InChI=1S/C16H24N4O3/c17-16(23)18-12-10-13(21)14(15(12)22)20-8-6-19(7-9-20)11-4-2-1-3-5-11/h1-5,12-15,21-22H,6-10H2,(H3,17,18,23)/t12-,13+,14-,15-/m1/s1 |
| InChIKey | AQWAMMRDWAIEJU-LXTVHRRPSA-N |
| XLogP | -0.66 |
| TPSA | 102.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |