C7H13NO — CID 155904518
[(1S,4S)-2-azabicyclo[2.2.1]heptan-4-yl]methanol (PubChem CID 155904518) has the molecular formula C7H13NO and a molecular weight of 127.19 g/mol. Its IUPAC name is [(1S,4S)-2-azabicyclo[2.2.1]heptan-4-yl]methanol.
| Compound Name | [(1S,4S)-2-azabicyclo[2.2.1]heptan-4-yl]methanol |
|---|---|
| PubChem CID | 155904518 |
| Molecular Formula | C7H13NO |
| Molecular Weight | 127.19 g/mol |
| Exact Mass | 127.10 |
| IUPAC Name | [(1S,4S)-2-azabicyclo[2.2.1]heptan-4-yl]methanol |
| SMILES | OC[C@@]12CC[C@@H](C1)NC2 |
| InChI | InChI=1S/C7H13NO/c9-5-7-2-1-6(3-7)8-4-7/h6,8-9H,1-5H2/t6-,7-/m0/s1 |
| InChIKey | SSGYWJKDARVKID-BQBZGAKWSA-N |
| XLogP | 0.12 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.19 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |