C13H17NO3 — CID 155905251
methyl 4-[(2R,4S)-4-hydroxypiperidin-2-yl]benzoate (PubChem CID 155905251) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is methyl 4-[(2R,4S)-4-hydroxypiperidin-2-yl]benzoate.
| Compound Name | methyl 4-[(2R,4S)-4-hydroxypiperidin-2-yl]benzoate |
|---|---|
| PubChem CID | 155905251 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | methyl 4-[(2R,4S)-4-hydroxypiperidin-2-yl]benzoate |
| SMILES | COC(=O)c1ccc([C@H]2C[C@@H](O)CCN2)cc1 |
| InChI | InChI=1S/C13H17NO3/c1-17-13(16)10-4-2-9(3-5-10)12-8-11(15)6-7-14-12/h2-5,11-12,14-15H,6-8H2,1H3/t11-,12+/m0/s1 |
| InChIKey | RCTMWTTULRQVQB-NWDGAFQWSA-N |
| XLogP | 1.26 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |