C18H19F2N3O2 — CID 170632746
methyl 4-[(2S)-4-[5-(difluoromethyl)pyrazin-2-yl]piperidin-2-yl]benzoate (PubChem CID 170632746) has the molecular formula C18H19F2N3O2 and a molecular weight of 347.37 g/mol. Its IUPAC name is methyl 4-[(2S)-4-[5-(difluoromethyl)pyrazin-2-yl]piperidin-2-yl]benzoate.
| Compound Name | methyl 4-[(2S)-4-[5-(difluoromethyl)pyrazin-2-yl]piperidin-2-yl]benzoate |
|---|---|
| PubChem CID | 170632746 |
| Molecular Formula | C18H19F2N3O2 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | methyl 4-[(2S)-4-[5-(difluoromethyl)pyrazin-2-yl]piperidin-2-yl]benzoate |
| SMILES | COC(=O)c1ccc([C@@H]2CC(c3cnc(C(F)F)cn3)CCN2)cc1 |
| InChI | InChI=1S/C18H19F2N3O2/c1-25-18(24)12-4-2-11(3-5-12)14-8-13(6-7-21-14)15-9-23-16(10-22-15)17(19)20/h2-5,9-10,13-14,17,21H,6-8H2,1H3/t13?,14-/m0/s1 |
| InChIKey | FNCXOIWOENQQSN-KZUDCZAMSA-N |
| XLogP | 3.41 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |