C14H18F2N2O2 — CID 175829180
methyl 4-[1-deuterio-4-(2,2-difluoroethyl)piperazin-2-yl]benzoate (PubChem CID 175829180) has the molecular formula C14H18F2N2O2 and a molecular weight of 285.31 g/mol. Its IUPAC name is methyl 4-[1-deuterio-4-(2,2-difluoroethyl)piperazin-2-yl]benzoate.
| Compound Name | methyl 4-[1-deuterio-4-(2,2-difluoroethyl)piperazin-2-yl]benzoate |
|---|---|
| PubChem CID | 175829180 |
| Molecular Formula | C14H18F2N2O2 |
| Molecular Weight | 285.31 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | methyl 4-[1-deuterio-4-(2,2-difluoroethyl)piperazin-2-yl]benzoate |
| SMILES | [2H]N1CCN(CC(F)F)CC1c1ccc(C(=O)OC)cc1 |
| InChI | InChI=1S/C14H18F2N2O2/c1-20-14(19)11-4-2-10(3-5-11)12-8-18(7-6-17-12)9-13(15)16/h2-5,12-13,17H,6-9H2,1H3/i/hD |
| InChIKey | RUWZBHMFECHBKI-DYCDLGHISA-N |
| XLogP | 1.68 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.31 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |