C14H17F2NO3 — CID 170982626
methyl 4-[(2R,4R)-4-(difluoromethoxy)piperidin-2-yl]benzoate (PubChem CID 170982626) has the molecular formula C14H17F2NO3 and a molecular weight of 285.29 g/mol. Its IUPAC name is methyl 4-[(2R,4R)-4-(difluoromethoxy)piperidin-2-yl]benzoate.
| Compound Name | methyl 4-[(2R,4R)-4-(difluoromethoxy)piperidin-2-yl]benzoate |
|---|---|
| PubChem CID | 170982626 |
| Molecular Formula | C14H17F2NO3 |
| Molecular Weight | 285.29 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | methyl 4-[(2R,4R)-4-(difluoromethoxy)piperidin-2-yl]benzoate |
| SMILES | COC(=O)c1ccc([C@H]2C[C@H](OC(F)F)CCN2)cc1 |
| InChI | InChI=1S/C14H17F2NO3/c1-19-13(18)10-4-2-9(3-5-10)12-8-11(6-7-17-12)20-14(15)16/h2-5,11-12,14,17H,6-8H2,1H3/t11-,12-/m1/s1 |
| InChIKey | JKTQLWYOMPAJRU-VXGBXAGGSA-N |
| XLogP | 2.51 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.29 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |