methyl 4-[(2R,4R)-4-(difluoromethoxy)piperidin-2-yl]benzoate

C14H17F2NO3 — CID 170982626

IUPACmethyl 4-[(2R,4R)-4-(difluoromethoxy)piperidin-2-yl]benzoate
SMILESCOC(=O)c1ccc([C@H]2C[C@H](OC(F)F)CCN2)cc1
InChIInChI=1S/C14H17F2NO3/c1-19-13(18)10-4-2-9(3-5-10)12-8-11(6-7-17-12)20-14(15)16/h2-5,11-12,14,17H,6-8H2,1H3/t11-,12-/m1/s1
InChIKeyJKTQLWYOMPAJRU-VXGBXAGGSA-N
MW285.29 g/mol
LogP2.51
Rot. Bonds4

About methyl 4-[(2R,4R)-4-(difluoromethoxy)piperidin-2-yl]benzoate

methyl 4-[(2R,4R)-4-(difluoromethoxy)piperidin-2-yl]benzoate (PubChem CID 170982626) has the molecular formula C14H17F2NO3 and a molecular weight of 285.29 g/mol. Its IUPAC name is methyl 4-[(2R,4R)-4-(difluoromethoxy)piperidin-2-yl]benzoate.

Molecular Properties

Compound Namemethyl 4-[(2R,4R)-4-(difluoromethoxy)piperidin-2-yl]benzoate
PubChem CID170982626
Molecular FormulaC14H17F2NO3
Molecular Weight285.29 g/mol
Exact Mass285.12
IUPAC Namemethyl 4-[(2R,4R)-4-(difluoromethoxy)piperidin-2-yl]benzoate
SMILESCOC(=O)c1ccc([C@H]2C[C@H](OC(F)F)CCN2)cc1
InChIInChI=1S/C14H17F2NO3/c1-19-13(18)10-4-2-9(3-5-10)12-8-11(6-7-17-12)20-14(15)16/h2-5,11-12,14,17H,6-8H2,1H3/t11-,12-/m1/s1
InChIKeyJKTQLWYOMPAJRU-VXGBXAGGSA-N
XLogP2.51
TPSA47.56 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500285.29
LogP ≤ 52.51
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze methyl 4-[(2R,4R)-4-(difluoromethoxy)piperidin-2-yl]benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-[(2R,4R)-4-(difluoromethoxy)piperidin-2-yl]benzoate?
The IUPAC name of methyl 4-[(2R,4R)-4-(difluoromethoxy)piperidin-2-yl]benzoate (CID 170982626) is methyl 4-[(2R,4R)-4-(difluoromethoxy)piperidin-2-yl]benzoate.
What is the SMILES notation for methyl 4-[(2R,4R)-4-(difluoromethoxy)piperidin-2-yl]benzoate?
The canonical SMILES for methyl 4-[(2R,4R)-4-(difluoromethoxy)piperidin-2-yl]benzoate is COC(=O)c1ccc([C@H]2C[C@H](OC(F)F)CCN2)cc1.
What is the InChIKey of methyl 4-[(2R,4R)-4-(difluoromethoxy)piperidin-2-yl]benzoate?
The InChIKey is JKTQLWYOMPAJRU-VXGBXAGGSA-N. The full InChI is InChI=1S/C14H17F2NO3/c1-19-13(18)10-4-2-9(3-5-10)12-8-11(6-7-17-12)20-14(15)16/h2-5,11-12,14,17H,6-8H2,1H3/t11-,12-/m1/s1.
What are the key properties of methyl 4-[(2R,4R)-4-(difluoromethoxy)piperidin-2-yl]benzoate?
methyl 4-[(2R,4R)-4-(difluoromethoxy)piperidin-2-yl]benzoate has a molecular weight of 285.29 g/mol, XLogP of 2.51, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[(2R,4R)-4-(difluoromethoxy)piperidin-2-yl]benzoate is sourced from PubChem (CID 170982626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).