C18H16BO3 — CID 155905821
(1,2-Oxaborinane-5,6-diyl)bis(phenylmethanone) (PubChem CID 155905821) has the molecular formula C18H16BO3 and a molecular weight of 291.14 g/mol.
| Compound Name | (1,2-Oxaborinane-5,6-diyl)bis(phenylmethanone) |
|---|---|
| PubChem CID | 155905821 |
| Molecular Formula | C18H16BO3 |
| Molecular Weight | 291.14 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | — |
| SMILES | O=C(c1ccccc1)C1CC[B]OC1C(=O)c1ccccc1 |
| InChI | InChI=1S/C18H16BO3/c20-16(13-7-3-1-4-8-13)15-11-12-19-22-18(15)17(21)14-9-5-2-6-10-14/h1-10,15,18H,11-12H2 |
| InChIKey | VCXMXMMSYFIYEC-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.14 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|