C30H25N3O3 — CID 155908619
2-[4-(4,5-diphenyl-1H-imidazol-2-yl)phenoxy]-N-(4-methoxyphenyl)acetamide (PubChem CID 155908619) has the molecular formula C30H25N3O3 and a molecular weight of 475.55 g/mol. Its IUPAC name is 2-[4-(4,5-diphenyl-1H-imidazol-2-yl)phenoxy]-N-(4-methoxyphenyl)acetamide.
| Compound Name | 2-[4-(4,5-diphenyl-1H-imidazol-2-yl)phenoxy]-N-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 155908619 |
| Molecular Formula | C30H25N3O3 |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | 2-[4-(4,5-diphenyl-1H-imidazol-2-yl)phenoxy]-N-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)COc2ccc(-c3nc(-c4ccccc4)c(-c4ccccc4)[nH]3)cc2)cc1 |
| InChI | InChI=1S/C30H25N3O3/c1-35-25-18-14-24(15-19-25)31-27(34)20-36-26-16-12-23(13-17-26)30-32-28(21-8-4-2-5-9-21)29(33-30)22-10-6-3-7-11-22/h2-19H,20H2,1H3,(H,31,34)(H,32,33) |
| InChIKey | WSUNTKLBUKKRRC-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'} |
|---|