C19H19N7O — CID 155909247
(3R,4R)-1-(2-amino-7H-purin-6-yl)-4-(quinolin-4-ylmethyl)pyrrolidin-3-ol (PubChem CID 155909247) has the molecular formula C19H19N7O and a molecular weight of 361.41 g/mol. Its IUPAC name is (3R,4R)-1-(2-amino-7H-purin-6-yl)-4-(quinolin-4-ylmethyl)pyrrolidin-3-ol.
| Compound Name | (3R,4R)-1-(2-amino-7H-purin-6-yl)-4-(quinolin-4-ylmethyl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 155909247 |
| Molecular Formula | C19H19N7O |
| Molecular Weight | 361.41 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | (3R,4R)-1-(2-amino-7H-purin-6-yl)-4-(quinolin-4-ylmethyl)pyrrolidin-3-ol |
| SMILES | Nc1nc(N2C[C@@H](Cc3ccnc4ccccc34)[C@@H](O)C2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C19H19N7O/c20-19-24-17-16(22-10-23-17)18(25-19)26-8-12(15(27)9-26)7-11-5-6-21-14-4-2-1-3-13(11)14/h1-6,10,12,15,27H,7-9H2,(H3,20,22,23,24,25)/t12-,15+/m1/s1 |
| InChIKey | CMSQCRAFVKKGGB-DOMZBBRYSA-N |
| XLogP | 1.52 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.41 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |