C9H9NOS — CID 15591627
1-(3-methyl-6H-thieno[2,3-b]pyrrol-4-yl)ethanone (PubChem CID 15591627) has the molecular formula C9H9NOS and a molecular weight of 179.24 g/mol. Its IUPAC name is 1-(3-methyl-6H-thieno[2,3-b]pyrrol-4-yl)ethanone.
| Compound Name | 1-(3-methyl-6H-thieno[2,3-b]pyrrol-4-yl)ethanone |
|---|---|
| PubChem CID | 15591627 |
| Molecular Formula | C9H9NOS |
| Molecular Weight | 179.24 g/mol |
| Exact Mass | 179.04 |
| IUPAC Name | 1-(3-methyl-6H-thieno[2,3-b]pyrrol-4-yl)ethanone |
| SMILES | CC(=O)c1c[nH]c2scc(C)c12 |
| InChI | InChI=1S/C9H9NOS/c1-5-4-12-9-8(5)7(3-10-9)6(2)11/h3-4,10H,1-2H3 |
| InChIKey | SVXGBHDSSNFEOQ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.24 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |