C29H33FN6O4 — CID 155919237
(2S,6R)-12-[2-(2-fluorophenyl)acetyl]-4-[3-(1,2,4-triazol-4-yl)propanoyl]-15-oxa-4,8,12-triazatricyclo[14.3.1.02,6]icosa-1(20),16,18-trien-7-one (PubChem CID 155919237) has the molecular formula C29H33FN6O4 and a molecular weight of 548.62 g/mol. Its IUPAC name is (2S,6R)-12-[2-(2-fluorophenyl)acetyl]-4-[3-(1,2,4-triazol-4-yl)propanoyl]-15-oxa-4,8,12-triazatricyclo[14.3.1.02,6]icosa-1(20),16,18-trien-7-one.
| Compound Name | (2S,6R)-12-[2-(2-fluorophenyl)acetyl]-4-[3-(1,2,4-triazol-4-yl)propanoyl]-15-oxa-4,8,12-triazatricyclo[14.3.1.02,6]icosa-1(20),16,18-trien-7-one |
|---|---|
| PubChem CID | 155919237 |
| Molecular Formula | C29H33FN6O4 |
| Molecular Weight | 548.62 g/mol |
| Exact Mass | 548.25 |
| IUPAC Name | (2S,6R)-12-[2-(2-fluorophenyl)acetyl]-4-[3-(1,2,4-triazol-4-yl)propanoyl]-15-oxa-4,8,12-triazatricyclo[14.3.1.02,6]icosa-1(20),16,18-trien-7-one |
| SMILES | O=C1NCCCN(C(=O)Cc2ccccc2F)CCOc2cccc(c2)[C@H]2CN(C(=O)CCn3cnnc3)C[C@H]12 |
| InChI | InChI=1S/C29H33FN6O4/c30-26-8-2-1-5-22(26)16-28(38)35-11-4-10-31-29(39)25-18-36(27(37)9-12-34-19-32-33-20-34)17-24(25)21-6-3-7-23(15-21)40-14-13-35/h1-3,5-8,15,19-20,24-25H,4,9-14,16-18H2,(H,31,39)/t24-,25+/m1/s1 |
| InChIKey | XMHNOWHOBLBDGL-RPBOFIJWSA-N |
| XLogP | 2.02 |
| TPSA | 109.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.62 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |