C12H11ClN4O2S — CID 155924872
4-chloro-2-oxo-N-(5-pyridin-4-yl-1,3,4-thiadiazol-2-yl)pentanamide (PubChem CID 155924872) has the molecular formula C12H11ClN4O2S and a molecular weight of 310.77 g/mol. Its IUPAC name is 4-chloro-2-oxo-N-(5-pyridin-4-yl-1,3,4-thiadiazol-2-yl)pentanamide.
| Compound Name | 4-chloro-2-oxo-N-(5-pyridin-4-yl-1,3,4-thiadiazol-2-yl)pentanamide |
|---|---|
| PubChem CID | 155924872 |
| Molecular Formula | C12H11ClN4O2S |
| Molecular Weight | 310.77 g/mol |
| Exact Mass | 310.03 |
| IUPAC Name | 4-chloro-2-oxo-N-(5-pyridin-4-yl-1,3,4-thiadiazol-2-yl)pentanamide |
| SMILES | CC(Cl)CC(=O)C(=O)Nc1nnc(-c2ccncc2)s1 |
| InChI | InChI=1S/C12H11ClN4O2S/c1-7(13)6-9(18)10(19)15-12-17-16-11(20-12)8-2-4-14-5-3-8/h2-5,7H,6H2,1H3,(H,15,17,19) |
| InChIKey | IKEDOEWAXZEZKH-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.77 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|