C21H36O3 — CID 155924905
(1R)-1-[(1R,4S,6R,9S,10R,12S)-6-hydroxy-5,5,9-trimethyl-13-tetracyclo[10.2.2.01,10.04,9]hexadecanyl]ethane-1,2-diol (PubChem CID 155924905) has the molecular formula C21H36O3 and a molecular weight of 336.52 g/mol. Its IUPAC name is (1R)-1-[(1R,4S,6R,9S,10R,12S)-6-hydroxy-5,5,9-trimethyl-13-tetracyclo[10.2.2.01,10.04,9]hexadecanyl]ethane-1,2-diol.
| Compound Name | (1R)-1-[(1R,4S,6R,9S,10R,12S)-6-hydroxy-5,5,9-trimethyl-13-tetracyclo[10.2.2.01,10.04,9]hexadecanyl]ethane-1,2-diol |
|---|---|
| PubChem CID | 155924905 |
| Molecular Formula | C21H36O3 |
| Molecular Weight | 336.52 g/mol |
| Exact Mass | 336.27 |
| IUPAC Name | (1R)-1-[(1R,4S,6R,9S,10R,12S)-6-hydroxy-5,5,9-trimethyl-13-tetracyclo[10.2.2.01,10.04,9]hexadecanyl]ethane-1,2-diol |
| SMILES | CC1(C)[C@H](O)CC[C@]2(C)[C@@H]1CC[C@@]13CC[C@@H](C[C@H]12)C([C@@H](O)CO)C3 |
| InChI | InChI=1S/C21H36O3/c1-19(2)16-5-9-21-8-4-13(14(11-21)15(23)12-22)10-17(21)20(16,3)7-6-18(19)24/h13-18,22-24H,4-12H2,1-3H3/t13-,14?,15-,16+,17-,18+,20+,21+/m0/s1 |
| InChIKey | ZBJGOMMGLUPHDY-OTAVTKIBSA-N |
| XLogP | 3.36 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.52 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |