C11H8N2OS — CID 155926286
1,5-dihydrochromeno[4,3-d]pyrimidine-2-thione (PubChem CID 155926286) has the molecular formula C11H8N2OS and a molecular weight of 216.27 g/mol. Its IUPAC name is 1,5-dihydrochromeno[4,3-d]pyrimidine-2-thione.
| Compound Name | 1,5-dihydrochromeno[4,3-d]pyrimidine-2-thione |
|---|---|
| PubChem CID | 155926286 |
| Molecular Formula | C11H8N2OS |
| Molecular Weight | 216.27 g/mol |
| Exact Mass | 216.04 |
| IUPAC Name | 1,5-dihydrochromeno[4,3-d]pyrimidine-2-thione |
| SMILES | S=c1ncc2c([nH]1)-c1ccccc1OC2 |
| InChI | InChI=1S/C11H8N2OS/c15-11-12-5-7-6-14-9-4-2-1-3-8(9)10(7)13-11/h1-5H,6H2,(H,12,13,15) |
| InChIKey | BQMYTTZJBKHWMH-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.27 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|