C17H15ClFN3OS — CID 24909652
6-[(4-chloro-6-fluoro-2H-chromen-3-yl)methyl]-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-2-thione (PubChem CID 24909652) has the molecular formula C17H15ClFN3OS and a molecular weight of 363.85 g/mol. Its IUPAC name is 6-[(4-chloro-6-fluoro-2H-chromen-3-yl)methyl]-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-2-thione.
| Compound Name | 6-[(4-chloro-6-fluoro-2H-chromen-3-yl)methyl]-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-2-thione |
|---|---|
| PubChem CID | 24909652 |
| Molecular Formula | C17H15ClFN3OS |
| Molecular Weight | 363.85 g/mol |
| Exact Mass | 363.06 |
| IUPAC Name | 6-[(4-chloro-6-fluoro-2H-chromen-3-yl)methyl]-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-2-thione |
| SMILES | Fc1ccc2c(c1)C(Cl)=C(CN1CCc3[nH]c(=S)ncc3C1)CO2 |
| InChI | InChI=1S/C17H15ClFN3OS/c18-16-11(9-23-15-2-1-12(19)5-13(15)16)8-22-4-3-14-10(7-22)6-20-17(24)21-14/h1-2,5-6H,3-4,7-9H2,(H,20,21,24) |
| InChIKey | LKIFZZTUXMZDSL-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 41.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.85 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|