C17H14ClN3O2S — CID 24910366
4-chloro-3-[(2-sulfanylidene-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-6-yl)methyl]chromen-2-one (PubChem CID 24910366) has the molecular formula C17H14ClN3O2S and a molecular weight of 359.84 g/mol. Its IUPAC name is 4-chloro-3-[(2-sulfanylidene-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-6-yl)methyl]chromen-2-one.
| Compound Name | 4-chloro-3-[(2-sulfanylidene-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-6-yl)methyl]chromen-2-one |
|---|---|
| PubChem CID | 24910366 |
| Molecular Formula | C17H14ClN3O2S |
| Molecular Weight | 359.84 g/mol |
| Exact Mass | 359.05 |
| IUPAC Name | 4-chloro-3-[(2-sulfanylidene-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-6-yl)methyl]chromen-2-one |
| SMILES | O=c1oc2ccccc2c(Cl)c1CN1CCc2[nH]c(=S)ncc2C1 |
| InChI | InChI=1S/C17H14ClN3O2S/c18-15-11-3-1-2-4-14(11)23-16(22)12(15)9-21-6-5-13-10(8-21)7-19-17(24)20-13/h1-4,7H,5-6,8-9H2,(H,19,20,24) |
| InChIKey | GLNQLFKBNHENOZ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.84 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|