C17H17N3OS — CID 24911563
6-(2H-chromen-3-ylmethyl)-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-2-thione (PubChem CID 24911563) has the molecular formula C17H17N3OS and a molecular weight of 311.41 g/mol. Its IUPAC name is 6-(2H-chromen-3-ylmethyl)-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-2-thione.
| Compound Name | 6-(2H-chromen-3-ylmethyl)-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-2-thione |
|---|---|
| PubChem CID | 24911563 |
| Molecular Formula | C17H17N3OS |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | 6-(2H-chromen-3-ylmethyl)-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-2-thione |
| SMILES | S=c1ncc2c([nH]1)CCN(CC1=Cc3ccccc3OC1)C2 |
| InChI | InChI=1S/C17H17N3OS/c22-17-18-8-14-10-20(6-5-15(14)19-17)9-12-7-13-3-1-2-4-16(13)21-11-12/h1-4,7-8H,5-6,9-11H2,(H,18,19,22) |
| InChIKey | UXBLDFAVQRTBKG-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 41.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|