About 2-[4-(3,5-dicyanophenoxy)-3,5-diethylpyrazol-1-yl]ethyl hydrogen sulfate
2-[4-(3,5-dicyanophenoxy)-3,5-diethylpyrazol-1-yl]ethyl hydrogen sulfate (PubChem CID 155928812) has the molecular formula C17H18N4O5S
and a molecular weight of 390.42 g/mol. Its IUPAC name is 2-[4-(3,5-dicyanophenoxy)-3,5-diethylpyrazol-1-yl]ethyl hydrogen sulfate.
Molecular Properties
| Compound Name | 2-[4-(3,5-dicyanophenoxy)-3,5-diethylpyrazol-1-yl]ethyl hydrogen sulfate |
| PubChem CID | 155928812 |
| Molecular Formula | C17H18N4O5S |
| Molecular Weight | 390.42 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | 2-[4-(3,5-dicyanophenoxy)-3,5-diethylpyrazol-1-yl]ethyl hydrogen sulfate |
| SMILES | CCc1nn(CCOS(=O)(=O)O)c(CC)c1Oc1cc(C#N)cc(C#N)c1 |
| InChI | InChI=1S/C17H18N4O5S/c1-3-15-17(26-14-8-12(10-18)7-13(9-14)11-19)16(4-2)21(20-15)5-6-25-27(22,23)24/h7-9H,3-6H2,1-2H3,(H,22,23,24) |
| InChIKey | YZOJOUPNUSVICK-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 138.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.42 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(3,5-dicyanophenoxy)-3,5-diethylpyrazol-1-yl]ethyl hydrogen sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(3,5-dicyanophenoxy)-3,5-diethylpyrazol-1-yl]ethyl hydrogen sulfate?
The IUPAC name of 2-[4-(3,5-dicyanophenoxy)-3,5-diethylpyrazol-1-yl]ethyl hydrogen sulfate (CID 155928812) is 2-[4-(3,5-dicyanophenoxy)-3,5-diethylpyrazol-1-yl]ethyl hydrogen sulfate.
What is the SMILES notation for 2-[4-(3,5-dicyanophenoxy)-3,5-diethylpyrazol-1-yl]ethyl hydrogen sulfate?
The canonical SMILES for 2-[4-(3,5-dicyanophenoxy)-3,5-diethylpyrazol-1-yl]ethyl hydrogen sulfate is CCc1nn(CCOS(=O)(=O)O)c(CC)c1Oc1cc(C#N)cc(C#N)c1.
What is the InChIKey of 2-[4-(3,5-dicyanophenoxy)-3,5-diethylpyrazol-1-yl]ethyl hydrogen sulfate?
The InChIKey is YZOJOUPNUSVICK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18N4O5S/c1-3-15-17(26-14-8-12(10-18)7-13(9-14)11-19)16(4-2)21(20-15)5-6-25-27(22,23)24/h7-9H,3-6H2,1-2H3,(H,22,23,24).
What are the key properties of 2-[4-(3,5-dicyanophenoxy)-3,5-diethylpyrazol-1-yl]ethyl hydrogen sulfate?
2-[4-(3,5-dicyanophenoxy)-3,5-diethylpyrazol-1-yl]ethyl hydrogen sulfate has a molecular weight of 390.42 g/mol, XLogP of 2.36, 8 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(3,5-dicyanophenoxy)-3,5-diethylpyrazol-1-yl]ethyl hydrogen sulfate is sourced from PubChem (CID 155928812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).