C17H18N4O5S — CID 155928812
2-[4-(3,5-dicyanophenoxy)-3,5-diethylpyrazol-1-yl]ethyl hydrogen sulfate (PubChem CID 155928812) has the molecular formula C17H18N4O5S and a molecular weight of 390.42 g/mol. Its IUPAC name is 2-[4-(3,5-dicyanophenoxy)-3,5-diethylpyrazol-1-yl]ethyl hydrogen sulfate.
| Compound Name | 2-[4-(3,5-dicyanophenoxy)-3,5-diethylpyrazol-1-yl]ethyl hydrogen sulfate |
|---|---|
| PubChem CID | 155928812 |
| Molecular Formula | C17H18N4O5S |
| Molecular Weight | 390.42 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | 2-[4-(3,5-dicyanophenoxy)-3,5-diethylpyrazol-1-yl]ethyl hydrogen sulfate |
| SMILES | CCc1nn(CCOS(=O)(=O)O)c(CC)c1Oc1cc(C#N)cc(C#N)c1 |
| InChI | InChI=1S/C17H18N4O5S/c1-3-15-17(26-14-8-12(10-18)7-13(9-14)11-19)16(4-2)21(20-15)5-6-25-27(22,23)24/h7-9H,3-6H2,1-2H3,(H,22,23,24) |
| InChIKey | YZOJOUPNUSVICK-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 138.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.42 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|