C23H28N4O3 — CID 21055132
3-[3,5-diethyl-1-[3-(oxan-2-yloxy)propyl]pyrazol-4-yl]oxy-5-isocyanobenzonitrile (PubChem CID 21055132) has the molecular formula C23H28N4O3 and a molecular weight of 408.50 g/mol. Its IUPAC name is 3-[3,5-diethyl-1-[3-(oxan-2-yloxy)propyl]pyrazol-4-yl]oxy-5-isocyanobenzonitrile.
| Compound Name | 3-[3,5-diethyl-1-[3-(oxan-2-yloxy)propyl]pyrazol-4-yl]oxy-5-isocyanobenzonitrile |
|---|---|
| PubChem CID | 21055132 |
| Molecular Formula | C23H28N4O3 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | 3-[3,5-diethyl-1-[3-(oxan-2-yloxy)propyl]pyrazol-4-yl]oxy-5-isocyanobenzonitrile |
| SMILES | [C-]#[N+]c1cc(C#N)cc(Oc2c(CC)nn(CCCOC3CCCCO3)c2CC)c1 |
| InChI | InChI=1S/C23H28N4O3/c1-4-20-23(30-19-14-17(16-24)13-18(15-19)25-3)21(5-2)27(26-20)10-8-12-29-22-9-6-7-11-28-22/h13-15,22H,4-12H2,1-2H3 |
| InChIKey | VOOJWBPCIVMIFG-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|