C17H23Cl2N3O — CID 173163505
2-[4-(3,5-dichlorophenoxy)-3,5-diethylpyrazol-1-yl]-N-ethylethanamine (PubChem CID 173163505) has the molecular formula C17H23Cl2N3O and a molecular weight of 356.30 g/mol. Its IUPAC name is 2-[4-(3,5-dichlorophenoxy)-3,5-diethylpyrazol-1-yl]-N-ethylethanamine.
| Compound Name | 2-[4-(3,5-dichlorophenoxy)-3,5-diethylpyrazol-1-yl]-N-ethylethanamine |
|---|---|
| PubChem CID | 173163505 |
| Molecular Formula | C17H23Cl2N3O |
| Molecular Weight | 356.30 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | 2-[4-(3,5-dichlorophenoxy)-3,5-diethylpyrazol-1-yl]-N-ethylethanamine |
| SMILES | CCNCCn1nc(CC)c(Oc2cc(Cl)cc(Cl)c2)c1CC |
| InChI | InChI=1S/C17H23Cl2N3O/c1-4-15-17(23-14-10-12(18)9-13(19)11-14)16(5-2)22(21-15)8-7-20-6-3/h9-11,20H,4-8H2,1-3H3 |
| InChIKey | ILGBKJVLQGTNSU-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.30 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|