C23H26N2O4 — CID 155929814
methyl (12S,15R,17S,19S)-13-(1-ethoxyethenyl)-19-hydroxy-1,11-diazapentacyclo[13.3.1.02,7.08,18.012,17]nonadeca-2,4,6,8(18),13-pentaene-17-carboxylate (PubChem CID 155929814) has the molecular formula C23H26N2O4 and a molecular weight of 394.47 g/mol. Its IUPAC name is methyl (12S,15R,17S,19S)-13-(1-ethoxyethenyl)-19-hydroxy-1,11-diazapentacyclo[13.3.1.02,7.08,18.012,17]nonadeca-2,4,6,8(18),13-pentaene-17-carboxylate.
| Compound Name | methyl (12S,15R,17S,19S)-13-(1-ethoxyethenyl)-19-hydroxy-1,11-diazapentacyclo[13.3.1.02,7.08,18.012,17]nonadeca-2,4,6,8(18),13-pentaene-17-carboxylate |
|---|---|
| PubChem CID | 155929814 |
| Molecular Formula | C23H26N2O4 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | methyl (12S,15R,17S,19S)-13-(1-ethoxyethenyl)-19-hydroxy-1,11-diazapentacyclo[13.3.1.02,7.08,18.012,17]nonadeca-2,4,6,8(18),13-pentaene-17-carboxylate |
| SMILES | C=C(OCC)C1=C[C@H]2C[C@@]3(C(=O)OC)c4c(c5ccccc5n4[C@H]2O)CCN[C@@H]13 |
| InChI | InChI=1S/C23H26N2O4/c1-4-29-13(2)17-11-14-12-23(22(27)28-3)19(17)24-10-9-16-15-7-5-6-8-18(15)25(20(16)23)21(14)26/h5-8,11,14,19,21,24,26H,2,4,9-10,12H2,1,3H3/t14-,19-,21-,23-/m0/s1 |
| InChIKey | QFCWXWQAKARGJW-AFDWAYAPSA-N |
| XLogP | 2.57 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|