C26H34O7 — CID 155929898
methyl (E,4R)-4-acetyloxy-6-[(1R,2R,3S,4S,7R)-7-acetyloxy-3-butyl-5-methyl-10-oxo-2-tricyclo[5.3.0.01,4]deca-5,8-dienyl]hex-5-enoate (PubChem CID 155929898) has the molecular formula C26H34O7 and a molecular weight of 458.55 g/mol. Its IUPAC name is methyl (E,4R)-4-acetyloxy-6-[(1R,2R,3S,4S,7R)-7-acetyloxy-3-butyl-5-methyl-10-oxo-2-tricyclo[5.3.0.01,4]deca-5,8-dienyl]hex-5-enoate.
| Compound Name | methyl (E,4R)-4-acetyloxy-6-[(1R,2R,3S,4S,7R)-7-acetyloxy-3-butyl-5-methyl-10-oxo-2-tricyclo[5.3.0.01,4]deca-5,8-dienyl]hex-5-enoate |
|---|---|
| PubChem CID | 155929898 |
| Molecular Formula | C26H34O7 |
| Molecular Weight | 458.55 g/mol |
| Exact Mass | 458.23 |
| IUPAC Name | methyl (E,4R)-4-acetyloxy-6-[(1R,2R,3S,4S,7R)-7-acetyloxy-3-butyl-5-methyl-10-oxo-2-tricyclo[5.3.0.01,4]deca-5,8-dienyl]hex-5-enoate |
| SMILES | CCCC[C@H]1[C@@H](/C=C/[C@@H](CCC(=O)OC)OC(C)=O)[C@]23C(=O)C=C[C@@]2(OC(C)=O)C=C(C)[C@H]13 |
| InChI | InChI=1S/C26H34O7/c1-6-7-8-20-21(11-9-19(32-17(3)27)10-12-23(30)31-5)26-22(29)13-14-25(26,33-18(4)28)15-16(2)24(20)26/h9,11,13-15,19-21,24H,6-8,10,12H2,1-5H3/b11-9+/t19-,20-,21+,24+,25+,26+/m0/s1 |
| InChIKey | CFEJYMGFYVRJJY-MTMXHPNQSA-N |
| XLogP | 3.87 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.55 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|