C25H34O8 — CID 162868892
methyl (E,4R)-4-acetyloxy-7-[(2S)-2-acetyloxy-2-[(Z,4R)-4-hydroxyoct-2-enyl]-5-oxocyclopent-3-en-1-ylidene]hept-5-enoate (PubChem CID 162868892) has the molecular formula C25H34O8 and a molecular weight of 462.54 g/mol. Its IUPAC name is methyl (E,4R)-4-acetyloxy-7-[(2S)-2-acetyloxy-2-[(Z,4R)-4-hydroxyoct-2-enyl]-5-oxocyclopent-3-en-1-ylidene]hept-5-enoate.
| Compound Name | methyl (E,4R)-4-acetyloxy-7-[(2S)-2-acetyloxy-2-[(Z,4R)-4-hydroxyoct-2-enyl]-5-oxocyclopent-3-en-1-ylidene]hept-5-enoate |
|---|---|
| PubChem CID | 162868892 |
| Molecular Formula | C25H34O8 |
| Molecular Weight | 462.54 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | methyl (E,4R)-4-acetyloxy-7-[(2S)-2-acetyloxy-2-[(Z,4R)-4-hydroxyoct-2-enyl]-5-oxocyclopent-3-en-1-ylidene]hept-5-enoate |
| SMILES | CCCC[C@@H](O)/C=C\C[C@]1(OC(C)=O)C=CC(=O)C1=C/C=C/[C@@H](CCC(=O)OC)OC(C)=O |
| InChI | InChI=1S/C25H34O8/c1-5-6-9-20(28)10-8-16-25(33-19(3)27)17-15-23(29)22(25)12-7-11-21(32-18(2)26)13-14-24(30)31-4/h7-8,10-12,15,17,20-21,28H,5-6,9,13-14,16H2,1-4H3/b10-8-,11-7+,22-12?/t20-,21+,25+/m1/s1 |
| InChIKey | CFDOZWZSBVKMSW-ZDMPKVRZSA-N |
| XLogP | 3.29 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.54 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|