C23H34O3 — CID 14540316
(4S,5E)-4-hydroxy-5-[(2Z,4R)-4-hydroxy-8-methylnona-2,7-dienylidene]-4-[(Z)-oct-2-enyl]cyclopent-2-en-1-one (PubChem CID 14540316) has the molecular formula C23H34O3 and a molecular weight of 358.52 g/mol. Its IUPAC name is (4S,5E)-4-hydroxy-5-[(2Z,4R)-4-hydroxy-8-methylnona-2,7-dienylidene]-4-[(Z)-oct-2-enyl]cyclopent-2-en-1-one.
| Compound Name | (4S,5E)-4-hydroxy-5-[(2Z,4R)-4-hydroxy-8-methylnona-2,7-dienylidene]-4-[(Z)-oct-2-enyl]cyclopent-2-en-1-one |
|---|---|
| PubChem CID | 14540316 |
| Molecular Formula | C23H34O3 |
| Molecular Weight | 358.52 g/mol |
| Exact Mass | 358.25 |
| IUPAC Name | (4S,5E)-4-hydroxy-5-[(2Z,4R)-4-hydroxy-8-methylnona-2,7-dienylidene]-4-[(Z)-oct-2-enyl]cyclopent-2-en-1-one |
| SMILES | CCCCC/C=C\C[C@]1(O)C=CC(=O)/C1=C/C=C\[C@H](O)CCC=C(C)C |
| InChI | InChI=1S/C23H34O3/c1-4-5-6-7-8-9-17-23(26)18-16-22(25)21(23)15-11-14-20(24)13-10-12-19(2)3/h8-9,11-12,14-16,18,20,24,26H,4-7,10,13,17H2,1-3H3/b9-8-,14-11-,21-15-/t20-,23+/m1/s1 |
| InChIKey | YTKIQRZMFKAFOL-YMADPOEOSA-N |
| XLogP | 4.97 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.52 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|