C28H32FNO2 — CID 155930481
tert-butyl (2R)-2-[[benzhydryl(benzyl)amino]methyl]-3-fluoropropanoate (PubChem CID 155930481) has the molecular formula C28H32FNO2 and a molecular weight of 433.57 g/mol. Its IUPAC name is tert-butyl (2R)-2-[[benzhydryl(benzyl)amino]methyl]-3-fluoropropanoate.
| Compound Name | tert-butyl (2R)-2-[[benzhydryl(benzyl)amino]methyl]-3-fluoropropanoate |
|---|---|
| PubChem CID | 155930481 |
| Molecular Formula | C28H32FNO2 |
| Molecular Weight | 433.57 g/mol |
| Exact Mass | 433.24 |
| IUPAC Name | tert-butyl (2R)-2-[[benzhydryl(benzyl)amino]methyl]-3-fluoropropanoate |
| SMILES | CC(C)(C)OC(=O)[C@H](CF)CN(Cc1ccccc1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H32FNO2/c1-28(2,3)32-27(31)25(19-29)21-30(20-22-13-7-4-8-14-22)26(23-15-9-5-10-16-23)24-17-11-6-12-18-24/h4-18,25-26H,19-21H2,1-3H3/t25-/m1/s1 |
| InChIKey | MJWWJPAKADKMCW-RUZDIDTESA-N |
| XLogP | 6.21 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.57 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |