C15H22O3 — CID 155931515
2,2,6,6,8,8-hexamethyl-3,4-dihydrochromene-5,7-dione (PubChem CID 155931515) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is 2,2,6,6,8,8-hexamethyl-3,4-dihydrochromene-5,7-dione.
| Compound Name | 2,2,6,6,8,8-hexamethyl-3,4-dihydrochromene-5,7-dione |
|---|---|
| PubChem CID | 155931515 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | 2,2,6,6,8,8-hexamethyl-3,4-dihydrochromene-5,7-dione |
| SMILES | CC1(C)CCC2=C(O1)C(C)(C)C(=O)C(C)(C)C2=O |
| InChI | InChI=1S/C15H22O3/c1-13(2)8-7-9-10(16)14(3,4)12(17)15(5,6)11(9)18-13/h7-8H2,1-6H3 |
| InChIKey | DXRDUNLMDXUNGG-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|