C25H29N3O4S2 — CID 155931567
1,3-bis-(4-methylphenyl)sulfonyl-5-[(1R)-1-phenylethyl]-1,3,5-triazinane (PubChem CID 155931567) has the molecular formula C25H29N3O4S2 and a molecular weight of 499.66 g/mol. Its IUPAC name is 1,3-bis-(4-methylphenyl)sulfonyl-5-[(1R)-1-phenylethyl]-1,3,5-triazinane.
| Compound Name | 1,3-bis-(4-methylphenyl)sulfonyl-5-[(1R)-1-phenylethyl]-1,3,5-triazinane |
|---|---|
| PubChem CID | 155931567 |
| Molecular Formula | C25H29N3O4S2 |
| Molecular Weight | 499.66 g/mol |
| Exact Mass | 499.16 |
| IUPAC Name | 1,3-bis-(4-methylphenyl)sulfonyl-5-[(1R)-1-phenylethyl]-1,3,5-triazinane |
| SMILES | Cc1ccc(S(=O)(=O)N2CN([C@H](C)c3ccccc3)CN(S(=O)(=O)c3ccc(C)cc3)C2)cc1 |
| InChI | InChI=1S/C25H29N3O4S2/c1-20-9-13-24(14-10-20)33(29,30)27-17-26(22(3)23-7-5-4-6-8-23)18-28(19-27)34(31,32)25-15-11-21(2)12-16-25/h4-16,22H,17-19H2,1-3H3/t22-/m1/s1 |
| InChIKey | RNHWIIWLVHNGAG-JOCHJYFZSA-N |
| XLogP | 3.93 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.66 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |