C9H17INO2S+ — CID 155932031
(3R,5R)-7-tert-butyl-5-methyl-1-iodonia-6λ6-thia-7-azaspiro[2.4]heptane 6,6-dioxide (PubChem CID 155932031) has the molecular formula C9H17INO2S+ and a molecular weight of 330.21 g/mol. Its IUPAC name is (3R,5R)-7-tert-butyl-5-methyl-1-iodonia-6λ6-thia-7-azaspiro[2.4]heptane 6,6-dioxide.
| Compound Name | (3R,5R)-7-tert-butyl-5-methyl-1-iodonia-6λ6-thia-7-azaspiro[2.4]heptane 6,6-dioxide |
|---|---|
| PubChem CID | 155932031 |
| Molecular Formula | C9H17INO2S+ |
| Molecular Weight | 330.21 g/mol |
| Exact Mass | 330.00 |
| IUPAC Name | (3R,5R)-7-tert-butyl-5-methyl-1-iodonia-6λ6-thia-7-azaspiro[2.4]heptane 6,6-dioxide |
| SMILES | C[C@@H]1C[C@@]2(C[I+]2)N(C(C)(C)C)S1(=O)=O |
| InChI | InChI=1S/C9H17INO2S/c1-7-5-9(6-10-9)11(8(2,3)4)14(7,12)13/h7H,5-6H2,1-4H3/q+1/t7-,9+/m1/s1 |
| InChIKey | SLKRMPLDWFFRFX-APPZFPTMSA-N |
| XLogP | -1.99 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.21 |
| LogP ≤ 5 | -1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|