C9H18INO2S — CID 155932176
(3R,5R)-2-tert-butyl-3-(iodomethyl)-5-methyl-1,2-thiazolidine 1,1-dioxide (PubChem CID 155932176) has the molecular formula C9H18INO2S and a molecular weight of 331.22 g/mol. Its IUPAC name is (3R,5R)-2-tert-butyl-3-(iodomethyl)-5-methyl-1,2-thiazolidine 1,1-dioxide.
| Compound Name | (3R,5R)-2-tert-butyl-3-(iodomethyl)-5-methyl-1,2-thiazolidine 1,1-dioxide |
|---|---|
| PubChem CID | 155932176 |
| Molecular Formula | C9H18INO2S |
| Molecular Weight | 331.22 g/mol |
| Exact Mass | 331.01 |
| IUPAC Name | (3R,5R)-2-tert-butyl-3-(iodomethyl)-5-methyl-1,2-thiazolidine 1,1-dioxide |
| SMILES | C[C@@H]1C[C@H](CI)N(C(C)(C)C)S1(=O)=O |
| InChI | InChI=1S/C9H18INO2S/c1-7-5-8(6-10)11(9(2,3)4)14(7,12)13/h7-8H,5-6H2,1-4H3/t7-,8-/m1/s1 |
| InChIKey | SEAJIOQXOGUHDK-HTQZYQBOSA-N |
| XLogP | 2.01 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.22 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|