C21H20INO4S2 — CID 155932063
ethyl (3S)-3-(2-iodophenyl)-3-[2-(thiophen-2-ylsulfonylamino)phenyl]propanoate (PubChem CID 155932063) has the molecular formula C21H20INO4S2 and a molecular weight of 541.43 g/mol. Its IUPAC name is ethyl (3S)-3-(2-iodophenyl)-3-[2-(thiophen-2-ylsulfonylamino)phenyl]propanoate.
| Compound Name | ethyl (3S)-3-(2-iodophenyl)-3-[2-(thiophen-2-ylsulfonylamino)phenyl]propanoate |
|---|---|
| PubChem CID | 155932063 |
| Molecular Formula | C21H20INO4S2 |
| Molecular Weight | 541.43 g/mol |
| Exact Mass | 540.99 |
| IUPAC Name | ethyl (3S)-3-(2-iodophenyl)-3-[2-(thiophen-2-ylsulfonylamino)phenyl]propanoate |
| SMILES | CCOC(=O)C[C@H](c1ccccc1I)c1ccccc1NS(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C21H20INO4S2/c1-2-27-20(24)14-17(15-8-3-5-10-18(15)22)16-9-4-6-11-19(16)23-29(25,26)21-12-7-13-28-21/h3-13,17,23H,2,14H2,1H3/t17-/m1/s1 |
| InChIKey | WHKZZGJIFSZCAW-QGZVFWFLSA-N |
| XLogP | 5.24 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.43 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|