C24H24INO4S — CID 155932062
ethyl (3S)-3-(2-iodophenyl)-3-[2-[(2-methylphenyl)sulfonylamino]phenyl]propanoate (PubChem CID 155932062) has the molecular formula C24H24INO4S and a molecular weight of 549.43 g/mol. Its IUPAC name is ethyl (3S)-3-(2-iodophenyl)-3-[2-[(2-methylphenyl)sulfonylamino]phenyl]propanoate.
| Compound Name | ethyl (3S)-3-(2-iodophenyl)-3-[2-[(2-methylphenyl)sulfonylamino]phenyl]propanoate |
|---|---|
| PubChem CID | 155932062 |
| Molecular Formula | C24H24INO4S |
| Molecular Weight | 549.43 g/mol |
| Exact Mass | 549.05 |
| IUPAC Name | ethyl (3S)-3-(2-iodophenyl)-3-[2-[(2-methylphenyl)sulfonylamino]phenyl]propanoate |
| SMILES | CCOC(=O)C[C@H](c1ccccc1I)c1ccccc1NS(=O)(=O)c1ccccc1C |
| InChI | InChI=1S/C24H24INO4S/c1-3-30-24(27)16-20(18-11-5-7-13-21(18)25)19-12-6-8-14-22(19)26-31(28,29)23-15-9-4-10-17(23)2/h4-15,20,26H,3,16H2,1-2H3/t20-/m1/s1 |
| InChIKey | DZJTXIBEMIVJOV-HXUWFJFHSA-N |
| XLogP | 5.49 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.43 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|