C19H21NO6S — CID 135078428
dimethyl 2-[[2-[(4-methylphenyl)sulfonylamino]phenyl]methyl]propanedioate (PubChem CID 135078428) has the molecular formula C19H21NO6S and a molecular weight of 391.45 g/mol. Its IUPAC name is dimethyl 2-[[2-[(4-methylphenyl)sulfonylamino]phenyl]methyl]propanedioate.
| Compound Name | dimethyl 2-[[2-[(4-methylphenyl)sulfonylamino]phenyl]methyl]propanedioate |
|---|---|
| PubChem CID | 135078428 |
| Molecular Formula | C19H21NO6S |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | dimethyl 2-[[2-[(4-methylphenyl)sulfonylamino]phenyl]methyl]propanedioate |
| SMILES | COC(=O)C(Cc1ccccc1NS(=O)(=O)c1ccc(C)cc1)C(=O)OC |
| InChI | InChI=1S/C19H21NO6S/c1-13-8-10-15(11-9-13)27(23,24)20-17-7-5-4-6-14(17)12-16(18(21)25-2)19(22)26-3/h4-11,16,20H,12H2,1-3H3 |
| InChIKey | CXZQSVIPCFKHJQ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|