C25H24ClNO4S2 — CID 155933110
ethyl 2-(2-chlorophenyl)sulfanyl-2-[(4-methylphenyl)sulfonyl-[(E)-2-phenylethenyl]amino]acetate (PubChem CID 155933110) has the molecular formula C25H24ClNO4S2 and a molecular weight of 502.06 g/mol. Its IUPAC name is ethyl 2-(2-chlorophenyl)sulfanyl-2-[(4-methylphenyl)sulfonyl-[(E)-2-phenylethenyl]amino]acetate.
| Compound Name | ethyl 2-(2-chlorophenyl)sulfanyl-2-[(4-methylphenyl)sulfonyl-[(E)-2-phenylethenyl]amino]acetate |
|---|---|
| PubChem CID | 155933110 |
| Molecular Formula | C25H24ClNO4S2 |
| Molecular Weight | 502.06 g/mol |
| Exact Mass | 501.08 |
| IUPAC Name | ethyl 2-(2-chlorophenyl)sulfanyl-2-[(4-methylphenyl)sulfonyl-[(E)-2-phenylethenyl]amino]acetate |
| SMILES | CCOC(=O)C(Sc1ccccc1Cl)N(/C=C/c1ccccc1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C25H24ClNO4S2/c1-3-31-25(28)24(32-23-12-8-7-11-22(23)26)27(18-17-20-9-5-4-6-10-20)33(29,30)21-15-13-19(2)14-16-21/h4-18,24H,3H2,1-2H3/b18-17+ |
| InChIKey | KGZHLGFWWZOUGB-ISLYRVAYSA-N |
| XLogP | 5.99 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.06 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|