C13H15N5O — CID 155933938
3-[(2R,3S)-3-azidobutan-2-yl]-1-methylquinoxalin-2-one (PubChem CID 155933938) has the molecular formula C13H15N5O and a molecular weight of 257.30 g/mol. Its IUPAC name is 3-[(2R,3S)-3-azidobutan-2-yl]-1-methylquinoxalin-2-one.
| Compound Name | 3-[(2R,3S)-3-azidobutan-2-yl]-1-methylquinoxalin-2-one |
|---|---|
| PubChem CID | 155933938 |
| Molecular Formula | C13H15N5O |
| Molecular Weight | 257.30 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | 3-[(2R,3S)-3-azidobutan-2-yl]-1-methylquinoxalin-2-one |
| SMILES | C[C@H](N=[N+]=[N-])[C@@H](C)c1nc2ccccc2n(C)c1=O |
| InChI | InChI=1S/C13H15N5O/c1-8(9(2)16-17-14)12-13(19)18(3)11-7-5-4-6-10(11)15-12/h4-9H,1-3H3/t8-,9+/m1/s1 |
| InChIKey | FEELUAUKUINFBY-BDAKNGLRSA-N |
| XLogP | 2.74 |
| TPSA | 83.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.30 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|