C12H23N3S2 — CID 155934067
2-ethylsulfanyl-N-(2-ethylsulfanylethyl)-N-(1H-imidazol-5-ylmethyl)ethanamine (PubChem CID 155934067) has the molecular formula C12H23N3S2 and a molecular weight of 273.47 g/mol. Its IUPAC name is 2-ethylsulfanyl-N-(2-ethylsulfanylethyl)-N-(1H-imidazol-5-ylmethyl)ethanamine.
| Compound Name | 2-ethylsulfanyl-N-(2-ethylsulfanylethyl)-N-(1H-imidazol-5-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 155934067 |
| Molecular Formula | C12H23N3S2 |
| Molecular Weight | 273.47 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | 2-ethylsulfanyl-N-(2-ethylsulfanylethyl)-N-(1H-imidazol-5-ylmethyl)ethanamine |
| SMILES | CCSCCN(CCSCC)Cc1cnc[nH]1 |
| InChI | InChI=1S/C12H23N3S2/c1-3-16-7-5-15(6-8-17-4-2)10-12-9-13-11-14-12/h9,11H,3-8,10H2,1-2H3,(H,13,14) |
| InChIKey | JTNJHPHIJGPRGZ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.47 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|