About 1-chloro-3-[(Z,6S)-6-ethenyl-1-phenylnon-4-en-5-yl]benzene
1-chloro-3-[(Z,6S)-6-ethenyl-1-phenylnon-4-en-5-yl]benzene (PubChem CID 155934470) has the molecular formula C23H27Cl
and a molecular weight of 338.92 g/mol. Its IUPAC name is 1-chloro-3-[(Z,6S)-6-ethenyl-1-phenylnon-4-en-5-yl]benzene.
Molecular Properties
| Compound Name | 1-chloro-3-[(Z,6S)-6-ethenyl-1-phenylnon-4-en-5-yl]benzene |
| PubChem CID | 155934470 |
| Molecular Formula | C23H27Cl |
| Molecular Weight | 338.92 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | 1-chloro-3-[(Z,6S)-6-ethenyl-1-phenylnon-4-en-5-yl]benzene |
| SMILES | C=C[C@H](CCC)/C(=C/CCCc1ccccc1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C23H27Cl/c1-3-11-20(4-2)23(21-15-10-16-22(24)18-21)17-9-8-14-19-12-6-5-7-13-19/h4-7,10,12-13,15-18,20H,2-3,8-9,11,14H2,1H3/b23-17-/t20-/m1/s1 |
| InChIKey | MFKVJYJAPQYPPG-AKWGVZKHSA-N |
| XLogP | 7.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 338.92 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-3-[(Z,6S)-6-ethenyl-1-phenylnon-4-en-5-yl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-3-[(Z,6S)-6-ethenyl-1-phenylnon-4-en-5-yl]benzene?
The IUPAC name of 1-chloro-3-[(Z,6S)-6-ethenyl-1-phenylnon-4-en-5-yl]benzene (CID 155934470) is 1-chloro-3-[(Z,6S)-6-ethenyl-1-phenylnon-4-en-5-yl]benzene.
What is the SMILES notation for 1-chloro-3-[(Z,6S)-6-ethenyl-1-phenylnon-4-en-5-yl]benzene?
The canonical SMILES for 1-chloro-3-[(Z,6S)-6-ethenyl-1-phenylnon-4-en-5-yl]benzene is C=C[C@H](CCC)/C(=C/CCCc1ccccc1)c1cccc(Cl)c1.
What is the InChIKey of 1-chloro-3-[(Z,6S)-6-ethenyl-1-phenylnon-4-en-5-yl]benzene?
The InChIKey is MFKVJYJAPQYPPG-AKWGVZKHSA-N. The full InChI is InChI=1S/C23H27Cl/c1-3-11-20(4-2)23(21-15-10-16-22(24)18-21)17-9-8-14-19-12-6-5-7-13-19/h4-7,10,12-13,15-18,20H,2-3,8-9,11,14H2,1H3/b23-17-/t20-/m1/s1.
What are the key properties of 1-chloro-3-[(Z,6S)-6-ethenyl-1-phenylnon-4-en-5-yl]benzene?
1-chloro-3-[(Z,6S)-6-ethenyl-1-phenylnon-4-en-5-yl]benzene has a molecular weight of 338.92 g/mol, XLogP of 7.35, 9 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-3-[(Z,6S)-6-ethenyl-1-phenylnon-4-en-5-yl]benzene is sourced from PubChem (CID 155934470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).