C20H33NO2 — CID 155935851
tert-butyl 4-[2-(4,4-dimethylcyclohexen-1-yl)ethyl]-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 155935851) has the molecular formula C20H33NO2 and a molecular weight of 319.49 g/mol. Its IUPAC name is tert-butyl 4-[2-(4,4-dimethylcyclohexen-1-yl)ethyl]-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-(4,4-dimethylcyclohexen-1-yl)ethyl]-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 155935851 |
| Molecular Formula | C20H33NO2 |
| Molecular Weight | 319.49 g/mol |
| Exact Mass | 319.25 |
| IUPAC Name | tert-butyl 4-[2-(4,4-dimethylcyclohexen-1-yl)ethyl]-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | CC1(C)CC=C(CCC2=CCN(C(=O)OC(C)(C)C)CC2)CC1 |
| InChI | InChI=1S/C20H33NO2/c1-19(2,3)23-18(22)21-14-10-17(11-15-21)7-6-16-8-12-20(4,5)13-9-16/h8,10H,6-7,9,11-15H2,1-5H3 |
| InChIKey | JLFDWGAHIAMIKF-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.49 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|