C27H22ClNO4S — CID 155936055
(2'S,4'S)-2'-(3-chlorophenyl)-4'-ethenyl-1'-(4-methylphenyl)sulfonylspiro[indene-2,3'-pyrrolidine]-1,3-dione (PubChem CID 155936055) has the molecular formula C27H22ClNO4S and a molecular weight of 492.00 g/mol. Its IUPAC name is (2'S,4'S)-2'-(3-chlorophenyl)-4'-ethenyl-1'-(4-methylphenyl)sulfonylspiro[indene-2,3'-pyrrolidine]-1,3-dione.
| Compound Name | (2'S,4'S)-2'-(3-chlorophenyl)-4'-ethenyl-1'-(4-methylphenyl)sulfonylspiro[indene-2,3'-pyrrolidine]-1,3-dione |
|---|---|
| PubChem CID | 155936055 |
| Molecular Formula | C27H22ClNO4S |
| Molecular Weight | 492.00 g/mol |
| Exact Mass | 491.10 |
| IUPAC Name | (2'S,4'S)-2'-(3-chlorophenyl)-4'-ethenyl-1'-(4-methylphenyl)sulfonylspiro[indene-2,3'-pyrrolidine]-1,3-dione |
| SMILES | C=C[C@@H]1CN(S(=O)(=O)c2ccc(C)cc2)[C@@H](c2cccc(Cl)c2)C12C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C27H22ClNO4S/c1-3-19-16-29(34(32,33)21-13-11-17(2)12-14-21)24(18-7-6-8-20(28)15-18)27(19)25(30)22-9-4-5-10-23(22)26(27)31/h3-15,19,24H,1,16H2,2H3/t19-,24+/m1/s1 |
| InChIKey | YYTSQPSHULWJST-DVECYGJZSA-N |
| XLogP | 5.26 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.00 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|