C27H22BrNO4S — CID 155936051
(2'S,4'S)-2'-(4-bromophenyl)-4'-ethenyl-1'-(4-methylphenyl)sulfonylspiro[indene-2,3'-pyrrolidine]-1,3-dione (PubChem CID 155936051) has the molecular formula C27H22BrNO4S and a molecular weight of 536.45 g/mol. Its IUPAC name is (2'S,4'S)-2'-(4-bromophenyl)-4'-ethenyl-1'-(4-methylphenyl)sulfonylspiro[indene-2,3'-pyrrolidine]-1,3-dione.
| Compound Name | (2'S,4'S)-2'-(4-bromophenyl)-4'-ethenyl-1'-(4-methylphenyl)sulfonylspiro[indene-2,3'-pyrrolidine]-1,3-dione |
|---|---|
| PubChem CID | 155936051 |
| Molecular Formula | C27H22BrNO4S |
| Molecular Weight | 536.45 g/mol |
| Exact Mass | 535.05 |
| IUPAC Name | (2'S,4'S)-2'-(4-bromophenyl)-4'-ethenyl-1'-(4-methylphenyl)sulfonylspiro[indene-2,3'-pyrrolidine]-1,3-dione |
| SMILES | C=C[C@@H]1CN(S(=O)(=O)c2ccc(C)cc2)[C@@H](c2ccc(Br)cc2)C12C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C27H22BrNO4S/c1-3-19-16-29(34(32,33)21-14-8-17(2)9-15-21)24(18-10-12-20(28)13-11-18)27(19)25(30)22-6-4-5-7-23(22)26(27)31/h3-15,19,24H,1,16H2,2H3/t19-,24+/m1/s1 |
| InChIKey | NSFSNGGRLYNMCB-DVECYGJZSA-N |
| XLogP | 5.37 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.45 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|