C22H22BrNO4S — CID 134852926
(1R,3aR,7aS)-1-(4-bromobenzoyl)-2-(4-methylphenyl)sulfonyl-3,3a,5,6,7,7a-hexahydro-1H-isoindol-4-one (PubChem CID 134852926) has the molecular formula C22H22BrNO4S and a molecular weight of 476.39 g/mol. Its IUPAC name is (1R,3aR,7aS)-1-(4-bromobenzoyl)-2-(4-methylphenyl)sulfonyl-3,3a,5,6,7,7a-hexahydro-1H-isoindol-4-one.
| Compound Name | (1R,3aR,7aS)-1-(4-bromobenzoyl)-2-(4-methylphenyl)sulfonyl-3,3a,5,6,7,7a-hexahydro-1H-isoindol-4-one |
|---|---|
| PubChem CID | 134852926 |
| Molecular Formula | C22H22BrNO4S |
| Molecular Weight | 476.39 g/mol |
| Exact Mass | 475.05 |
| IUPAC Name | (1R,3aR,7aS)-1-(4-bromobenzoyl)-2-(4-methylphenyl)sulfonyl-3,3a,5,6,7,7a-hexahydro-1H-isoindol-4-one |
| SMILES | Cc1ccc(S(=O)(=O)N2C[C@@H]3C(=O)CCC[C@@H]3[C@@H]2C(=O)c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C22H22BrNO4S/c1-14-5-11-17(12-6-14)29(27,28)24-13-19-18(3-2-4-20(19)25)21(24)22(26)15-7-9-16(23)10-8-15/h5-12,18-19,21H,2-4,13H2,1H3/t18-,19-,21+/m0/s1 |
| InChIKey | YCAYWYGCQZLPTL-IRFCIJBXSA-N |
| XLogP | 4.00 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.39 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |