C21H22BrNO3S — CID 134951915
(2-bromophenyl)-[(3S,4R)-1-(4-methylphenyl)sulfonyl-4-prop-1-en-2-ylpyrrolidin-3-yl]methanone (PubChem CID 134951915) has the molecular formula C21H22BrNO3S and a molecular weight of 448.38 g/mol. Its IUPAC name is (2-bromophenyl)-[(3S,4R)-1-(4-methylphenyl)sulfonyl-4-prop-1-en-2-ylpyrrolidin-3-yl]methanone.
| Compound Name | (2-bromophenyl)-[(3S,4R)-1-(4-methylphenyl)sulfonyl-4-prop-1-en-2-ylpyrrolidin-3-yl]methanone |
|---|---|
| PubChem CID | 134951915 |
| Molecular Formula | C21H22BrNO3S |
| Molecular Weight | 448.38 g/mol |
| Exact Mass | 447.05 |
| IUPAC Name | (2-bromophenyl)-[(3S,4R)-1-(4-methylphenyl)sulfonyl-4-prop-1-en-2-ylpyrrolidin-3-yl]methanone |
| SMILES | C=C(C)[C@@H]1CN(S(=O)(=O)c2ccc(C)cc2)C[C@H]1C(=O)c1ccccc1Br |
| InChI | InChI=1S/C21H22BrNO3S/c1-14(2)18-12-23(27(25,26)16-10-8-15(3)9-11-16)13-19(18)21(24)17-6-4-5-7-20(17)22/h4-11,18-19H,1,12-13H2,2-3H3/t18-,19+/m0/s1 |
| InChIKey | BKCUOWCMDATKIS-RBUKOAKNSA-N |
| XLogP | 4.45 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.38 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|