C26H24BrNO3S — CID 166447905
(2E)-2-(4-bromophenyl)-2-[(4S)-4-methyl-1-(4-methylphenyl)sulfonylpyrrolidin-3-ylidene]-1-phenylethanone (PubChem CID 166447905) has the molecular formula C26H24BrNO3S and a molecular weight of 510.45 g/mol. Its IUPAC name is (2E)-2-(4-bromophenyl)-2-[(4S)-4-methyl-1-(4-methylphenyl)sulfonylpyrrolidin-3-ylidene]-1-phenylethanone.
| Compound Name | (2E)-2-(4-bromophenyl)-2-[(4S)-4-methyl-1-(4-methylphenyl)sulfonylpyrrolidin-3-ylidene]-1-phenylethanone |
|---|---|
| PubChem CID | 166447905 |
| Molecular Formula | C26H24BrNO3S |
| Molecular Weight | 510.45 g/mol |
| Exact Mass | 509.07 |
| IUPAC Name | (2E)-2-(4-bromophenyl)-2-[(4S)-4-methyl-1-(4-methylphenyl)sulfonylpyrrolidin-3-ylidene]-1-phenylethanone |
| SMILES | Cc1ccc(S(=O)(=O)N2C/C(=C(/C(=O)c3ccccc3)c3ccc(Br)cc3)[C@H](C)C2)cc1 |
| InChI | InChI=1S/C26H24BrNO3S/c1-18-8-14-23(15-9-18)32(30,31)28-16-19(2)24(17-28)25(20-10-12-22(27)13-11-20)26(29)21-6-4-3-5-7-21/h3-15,19H,16-17H2,1-2H3/b25-24-/t19-/m1/s1 |
| InChIKey | FFXCRLISQADNEB-KRXRYSOXSA-N |
| XLogP | 5.73 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.45 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|