C30H25NO4S — CID 134951671
(3S,5aS)-2-(4-methylphenyl)sulfonyl-3-phenylspiro[3,5a,6,8-tetrahydrocyclopenta[c]azepine-7,2'-indene]-1',3'-dione (PubChem CID 134951671) has the molecular formula C30H25NO4S and a molecular weight of 495.60 g/mol. Its IUPAC name is (3S,5aS)-2-(4-methylphenyl)sulfonyl-3-phenylspiro[3,5a,6,8-tetrahydrocyclopenta[c]azepine-7,2'-indene]-1',3'-dione.
| Compound Name | (3S,5aS)-2-(4-methylphenyl)sulfonyl-3-phenylspiro[3,5a,6,8-tetrahydrocyclopenta[c]azepine-7,2'-indene]-1',3'-dione |
|---|---|
| PubChem CID | 134951671 |
| Molecular Formula | C30H25NO4S |
| Molecular Weight | 495.60 g/mol |
| Exact Mass | 495.15 |
| IUPAC Name | (3S,5aS)-2-(4-methylphenyl)sulfonyl-3-phenylspiro[3,5a,6,8-tetrahydrocyclopenta[c]azepine-7,2'-indene]-1',3'-dione |
| SMILES | Cc1ccc(S(=O)(=O)N2C=C3CC4(C[C@H]3C=C[C@H]2c2ccccc2)C(=O)c2ccccc2C4=O)cc1 |
| InChI | InChI=1S/C30H25NO4S/c1-20-11-14-24(15-12-20)36(34,35)31-19-23-18-30(28(32)25-9-5-6-10-26(25)29(30)33)17-22(23)13-16-27(31)21-7-3-2-4-8-21/h2-16,19,22,27H,17-18H2,1H3/t22-,27+/m1/s1 |
| InChIKey | LOMNFKHGOZZHHQ-AMGIVPHBSA-N |
| XLogP | 5.66 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.60 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|