C27H23NO4S — CID 155936061
(2'R,4'S)-4'-ethenyl-1'-(4-methylphenyl)sulfonyl-2'-phenylspiro[indene-2,3'-pyrrolidine]-1,3-dione (PubChem CID 155936061) has the molecular formula C27H23NO4S and a molecular weight of 457.55 g/mol. Its IUPAC name is (2'R,4'S)-4'-ethenyl-1'-(4-methylphenyl)sulfonyl-2'-phenylspiro[indene-2,3'-pyrrolidine]-1,3-dione.
| Compound Name | (2'R,4'S)-4'-ethenyl-1'-(4-methylphenyl)sulfonyl-2'-phenylspiro[indene-2,3'-pyrrolidine]-1,3-dione |
|---|---|
| PubChem CID | 155936061 |
| Molecular Formula | C27H23NO4S |
| Molecular Weight | 457.55 g/mol |
| Exact Mass | 457.13 |
| IUPAC Name | (2'R,4'S)-4'-ethenyl-1'-(4-methylphenyl)sulfonyl-2'-phenylspiro[indene-2,3'-pyrrolidine]-1,3-dione |
| SMILES | C=C[C@@H]1CN(S(=O)(=O)c2ccc(C)cc2)[C@H](c2ccccc2)C12C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C27H23NO4S/c1-3-20-17-28(33(31,32)21-15-13-18(2)14-16-21)24(19-9-5-4-6-10-19)27(20)25(29)22-11-7-8-12-23(22)26(27)30/h3-16,20,24H,1,17H2,2H3/t20-,24-/m1/s1 |
| InChIKey | IJNMGFHTKKCBQZ-HYBUGGRVSA-N |
| XLogP | 4.61 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.55 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|