C26H19N3O — CID 155936570
phenyl-[(7R,8S)-8-phenyl-6,9,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(16),2,4,10,12,14-hexaen-7-yl]methanone (PubChem CID 155936570) has the molecular formula C26H19N3O and a molecular weight of 389.46 g/mol. Its IUPAC name is phenyl-[(7R,8S)-8-phenyl-6,9,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(16),2,4,10,12,14-hexaen-7-yl]methanone.
| Compound Name | phenyl-[(7R,8S)-8-phenyl-6,9,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(16),2,4,10,12,14-hexaen-7-yl]methanone |
|---|---|
| PubChem CID | 155936570 |
| Molecular Formula | C26H19N3O |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | phenyl-[(7R,8S)-8-phenyl-6,9,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(16),2,4,10,12,14-hexaen-7-yl]methanone |
| SMILES | O=C(c1ccccc1)[C@H]1[C@H](c2ccccc2)n2c(nc3ccccc32)-c2cccn21 |
| InChI | InChI=1S/C26H19N3O/c30-25(19-12-5-2-6-13-19)24-23(18-10-3-1-4-11-18)29-21-15-8-7-14-20(21)27-26(29)22-16-9-17-28(22)24/h1-17,23-24H/t23-,24+/m0/s1 |
| InChIKey | WRHRVWFXMFXLOS-BJKOFHAPSA-N |
| XLogP | 5.53 |
| TPSA | 39.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |